C11H11FN2O — CID 177226919
2-(3-fluoro-6-methyl-1,5-naphthyridin-4-yl)ethanol (PubChem CID 177226919) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-(3-fluoro-6-methyl-1,5-naphthyridin-4-yl)ethanol.
| Compound Name | 2-(3-fluoro-6-methyl-1,5-naphthyridin-4-yl)ethanol |
|---|---|
| PubChem CID | 177226919 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-(3-fluoro-6-methyl-1,5-naphthyridin-4-yl)ethanol |
| SMILES | Cc1ccc2ncc(F)c(CCO)c2n1 |
| InChI | InChI=1S/C11H11FN2O/c1-7-2-3-10-11(14-7)8(4-5-15)9(12)6-13-10/h2-3,6,15H,4-5H2,1H3 |
| InChIKey | OZHXPALRNJNEDU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |