C12H14BNO2 — CID 177227321
CID 177227321 (PubChem CID 177227321) has the molecular formula C12H14BNO2 and a molecular weight of 215.06 g/mol.
| Compound Name | CID 177227321 |
|---|---|
| PubChem CID | 177227321 |
| Molecular Formula | C12H14BNO2 |
| Molecular Weight | 215.06 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(OC2CC(C(=O)NC)C2)cc1 |
| InChI | InChI=1S/C12H14BNO2/c1-14-12(15)8-6-11(7-8)16-10-4-2-9(13)3-5-10/h2-5,8,11H,6-7H2,1H3,(H,14,15) |
| InChIKey | VAEJULRDDAFKIS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.06 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|