C16H24F3N3 — CID 177229845
ethane;5-(1-ethyl-5-methylpyrazol-3-yl)-2-(trifluoromethyl)pyridine (PubChem CID 177229845) has the molecular formula C16H24F3N3 and a molecular weight of 315.38 g/mol. Its IUPAC name is ethane;5-(1-ethyl-5-methylpyrazol-3-yl)-2-(trifluoromethyl)pyridine.
| Compound Name | ethane;5-(1-ethyl-5-methylpyrazol-3-yl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 177229845 |
| Molecular Formula | C16H24F3N3 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | ethane;5-(1-ethyl-5-methylpyrazol-3-yl)-2-(trifluoromethyl)pyridine |
| SMILES | CC.CC.CCn1nc(-c2ccc(C(F)(F)F)nc2)cc1C |
| InChI | InChI=1S/C12H12F3N3.2C2H6/c1-3-18-8(2)6-10(17-18)9-4-5-11(16-7-9)12(13,14)15;2*1-2/h4-7H,3H2,1-2H3;2*1-2H3 |
| InChIKey | YYNHCDBOGOVFLL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |