C15H30N2O4S — CID 177231285
tert-butyl 2-[4-(methoxyamino)-3-oxobutyl]pyrrolidine-1-carboxylate;methanethiol (PubChem CID 177231285) has the molecular formula C15H30N2O4S and a molecular weight of 334.48 g/mol. Its IUPAC name is tert-butyl 2-[4-(methoxyamino)-3-oxobutyl]pyrrolidine-1-carboxylate;methanethiol.
| Compound Name | tert-butyl 2-[4-(methoxyamino)-3-oxobutyl]pyrrolidine-1-carboxylate;methanethiol |
|---|---|
| PubChem CID | 177231285 |
| Molecular Formula | C15H30N2O4S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | tert-butyl 2-[4-(methoxyamino)-3-oxobutyl]pyrrolidine-1-carboxylate;methanethiol |
| SMILES | CONCC(=O)CCC1CCCN1C(=O)OC(C)(C)C.CS |
| InChI | InChI=1S/C14H26N2O4.CH4S/c1-14(2,3)20-13(18)16-9-5-6-11(16)7-8-12(17)10-15-19-4;1-2/h11,15H,5-10H2,1-4H3;2H,1H3 |
| InChIKey | OKDQNPKLITWSQN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|