C8H12FNO — CID 177231878
(E)-4-[(2R,4S)-4-fluoropyrrolidin-2-yl]but-3-en-2-one (PubChem CID 177231878) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is (E)-4-[(2R,4S)-4-fluoropyrrolidin-2-yl]but-3-en-2-one.
| Compound Name | (E)-4-[(2R,4S)-4-fluoropyrrolidin-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 177231878 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (E)-4-[(2R,4S)-4-fluoropyrrolidin-2-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C8H12FNO/c1-6(11)2-3-8-4-7(9)5-10-8/h2-3,7-8,10H,4-5H2,1H3/b3-2+/t7-,8-/m0/s1 |
| InChIKey | ZMMAWPQNJGDDSD-HZIBQTDNSA-N |
| XLogP | 0.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|