C9H13F2NO — CID 177231188
(E)-5-[(2S)-4,4-difluoropyrrolidin-2-yl]pent-3-en-2-one (PubChem CID 177231188) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is (E)-5-[(2S)-4,4-difluoropyrrolidin-2-yl]pent-3-en-2-one.
| Compound Name | (E)-5-[(2S)-4,4-difluoropyrrolidin-2-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 177231188 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (E)-5-[(2S)-4,4-difluoropyrrolidin-2-yl]pent-3-en-2-one |
| SMILES | CC(=O)/C=C/C[C@H]1CC(F)(F)CN1 |
| InChI | InChI=1S/C9H13F2NO/c1-7(13)3-2-4-8-5-9(10,11)6-12-8/h2-3,8,12H,4-6H2,1H3/b3-2+/t8-/m0/s1 |
| InChIKey | NYHXPTBICKGDLL-SGJFDWMWSA-N |
| XLogP | 1.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|