C12H17F2N3O — CID 177233933
6-[(4,4-difluorocyclohexyl)amino]-2,3-dimethylpyrimidin-4-one (PubChem CID 177233933) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 6-[(4,4-difluorocyclohexyl)amino]-2,3-dimethylpyrimidin-4-one.
| Compound Name | 6-[(4,4-difluorocyclohexyl)amino]-2,3-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 177233933 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 6-[(4,4-difluorocyclohexyl)amino]-2,3-dimethylpyrimidin-4-one |
| SMILES | Cc1nc(NC2CCC(F)(F)CC2)cc(=O)n1C |
| InChI | InChI=1S/C12H17F2N3O/c1-8-15-10(7-11(18)17(8)2)16-9-3-5-12(13,14)6-4-9/h7,9,16H,3-6H2,1-2H3 |
| InChIKey | CHSPJORJABYXSF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |