C15H21N3 — CID 177235602
6-[3-(3,3-dimethylazetidin-1-yl)-3-methylbut-1-ynyl]pyridin-3-amine (PubChem CID 177235602) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 6-[3-(3,3-dimethylazetidin-1-yl)-3-methylbut-1-ynyl]pyridin-3-amine.
| Compound Name | 6-[3-(3,3-dimethylazetidin-1-yl)-3-methylbut-1-ynyl]pyridin-3-amine |
|---|---|
| PubChem CID | 177235602 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 6-[3-(3,3-dimethylazetidin-1-yl)-3-methylbut-1-ynyl]pyridin-3-amine |
| SMILES | CC1(C)CN(C(C)(C)C#Cc2ccc(N)cn2)C1 |
| InChI | InChI=1S/C15H21N3/c1-14(2)10-18(11-14)15(3,4)8-7-13-6-5-12(16)9-17-13/h5-6,9H,10-11,16H2,1-4H3 |
| InChIKey | RRNDMSHDDZCSSJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|