C31H21ClF3N5OS — CID 177237091
6-[5-(4-chlorophenyl)-2-[4-[2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]sulfanylphenyl]-1,2,4-triazol-3-yl]quinoxaline (PubChem CID 177237091) has the molecular formula C31H21ClF3N5OS and a molecular weight of 604.06 g/mol. Its IUPAC name is 6-[5-(4-chlorophenyl)-2-[4-[2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]sulfanylphenyl]-1,2,4-triazol-3-yl]quinoxaline.
| Compound Name | 6-[5-(4-chlorophenyl)-2-[4-[2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]sulfanylphenyl]-1,2,4-triazol-3-yl]quinoxaline |
|---|---|
| PubChem CID | 177237091 |
| Molecular Formula | C31H21ClF3N5OS |
| Molecular Weight | 604.06 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | 6-[5-(4-chlorophenyl)-2-[4-[2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]sulfanylphenyl]-1,2,4-triazol-3-yl]quinoxaline |
| SMILES | Cc1ccc(C(OSc2ccc(-n3nc(-c4ccc(Cl)cc4)nc3-c3ccc4nccnc4c3)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H21ClF3N5OS/c1-19-2-4-20(5-3-19)28(31(33,34)35)41-42-25-13-11-24(12-14-25)40-30(22-8-15-26-27(18-22)37-17-16-36-26)38-29(39-40)21-6-9-23(32)10-7-21/h2-18,28H,1H3 |
| InChIKey | FBZGHIBKIIZLOU-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.06 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|