C23H14ClN5O2 — CID 177237121
3-[3-(4-chlorophenyl)-5-quinoxalin-6-yl-1,2,4-triazol-1-yl]benzoic acid (PubChem CID 177237121) has the molecular formula C23H14ClN5O2 and a molecular weight of 427.85 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-5-quinoxalin-6-yl-1,2,4-triazol-1-yl]benzoic acid.
| Compound Name | 3-[3-(4-chlorophenyl)-5-quinoxalin-6-yl-1,2,4-triazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 177237121 |
| Molecular Formula | C23H14ClN5O2 |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-5-quinoxalin-6-yl-1,2,4-triazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2nc(-c3ccc(Cl)cc3)nc2-c2ccc3nccnc3c2)c1 |
| InChI | InChI=1S/C23H14ClN5O2/c24-17-7-4-14(5-8-17)21-27-22(15-6-9-19-20(13-15)26-11-10-25-19)29(28-21)18-3-1-2-16(12-18)23(30)31/h1-13H,(H,30,31) |
| InChIKey | IRYKKSHIOCYRHP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |