molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine

C14H18N2 — CID 177237775

IUPACmolecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine
SMILESCC(C)c1cncc(Nc2ccccc2)c1.[H][H]
InChIInChI=1S/C14H16N2.H2/c1-11(2)12-8-14(10-15-9-12)16-13-6-4-3-5-7-13;/h3-11,16H,1-2H3;1H
InChIKeyDOURBCJILNZNOY-UHFFFAOYSA-N
MW214.31 g/mol
LogP4.19
Rot. Bonds3

About molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine

molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine (PubChem CID 177237775) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine.

Molecular Properties

Compound Namemolecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine
PubChem CID177237775
Molecular FormulaC14H18N2
Molecular Weight214.31 g/mol
Exact Mass214.15
IUPAC Namemolecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine
SMILESCC(C)c1cncc(Nc2ccccc2)c1.[H][H]
InChIInChI=1S/C14H16N2.H2/c1-11(2)12-8-14(10-15-9-12)16-13-6-4-3-5-7-13;/h3-11,16H,1-2H3;1H
InChIKeyDOURBCJILNZNOY-UHFFFAOYSA-N
XLogP4.19
TPSA24.92 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 54.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine?
The IUPAC name of molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine (CID 177237775) is molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine.
What is the SMILES notation for molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine?
The canonical SMILES for molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine is CC(C)c1cncc(Nc2ccccc2)c1.[H][H].
What is the InChIKey of molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine?
The InChIKey is DOURBCJILNZNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2.H2/c1-11(2)12-8-14(10-15-9-12)16-13-6-4-3-5-7-13;/h3-11,16H,1-2H3;1H.
What are the key properties of molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine?
molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine has a molecular weight of 214.31 g/mol, XLogP of 4.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-phenyl-5-propan-2-ylpyridin-3-amine is sourced from PubChem (CID 177237775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).