C18H25ClIN3O4 — CID 177238791
tert-butyl 6-(3-chloropropylcarbamoylamino)-4-iodo-5-methoxy-1,3-dihydroisoindole-2-carboxylate (PubChem CID 177238791) has the molecular formula C18H25ClIN3O4 and a molecular weight of 509.77 g/mol. Its IUPAC name is tert-butyl 6-(3-chloropropylcarbamoylamino)-4-iodo-5-methoxy-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 6-(3-chloropropylcarbamoylamino)-4-iodo-5-methoxy-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 177238791 |
| Molecular Formula | C18H25ClIN3O4 |
| Molecular Weight | 509.77 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | tert-butyl 6-(3-chloropropylcarbamoylamino)-4-iodo-5-methoxy-1,3-dihydroisoindole-2-carboxylate |
| SMILES | COc1c(NC(=O)NCCCCl)cc2c(c1I)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C18H25ClIN3O4/c1-18(2,3)27-17(25)23-9-11-8-13(22-16(24)21-7-5-6-19)15(26-4)14(20)12(11)10-23/h8H,5-7,9-10H2,1-4H3,(H2,21,22,24) |
| InChIKey | SJRPUQWMPKIODM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|