C20H30N2O5 — CID 177239150
tert-butyl 5-ethoxy-6-[formyl(3-methoxypropyl)amino]-1,3-dihydroisoindole-2-carboxylate (PubChem CID 177239150) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is tert-butyl 5-ethoxy-6-[formyl(3-methoxypropyl)amino]-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-ethoxy-6-[formyl(3-methoxypropyl)amino]-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 177239150 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | tert-butyl 5-ethoxy-6-[formyl(3-methoxypropyl)amino]-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CCOc1cc2c(cc1N(C=O)CCCOC)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C20H30N2O5/c1-6-26-18-11-16-13-22(19(24)27-20(2,3)4)12-15(16)10-17(18)21(14-23)8-7-9-25-5/h10-11,14H,6-9,12-13H2,1-5H3 |
| InChIKey | CTHGMVAVDAIXSS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|