C28H23Cl3F2N4O5S — CID 177238895
N-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-cyanophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-6-methoxy-1,3-dihydroisoindol-5-yl]-N-(3-methoxypropyl)formamide (PubChem CID 177238895) has the molecular formula C28H23Cl3F2N4O5S and a molecular weight of 671.94 g/mol. Its IUPAC name is N-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-cyanophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-6-methoxy-1,3-dihydroisoindol-5-yl]-N-(3-methoxypropyl)formamide.
| Compound Name | N-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-cyanophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-6-methoxy-1,3-dihydroisoindol-5-yl]-N-(3-methoxypropyl)formamide |
|---|---|
| PubChem CID | 177238895 |
| Molecular Formula | C28H23Cl3F2N4O5S |
| Molecular Weight | 671.94 g/mol |
| Exact Mass | 670.04 |
| IUPAC Name | N-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-cyanophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-6-methoxy-1,3-dihydroisoindol-5-yl]-N-(3-methoxypropyl)formamide |
| SMILES | COCCCN(C=O)c1cc2c(cc1OC)CN(C(=O)c1c(Sc3c(Cl)ccc(C#N)c3Cl)cc(C(F)(F)Cl)[nH]c1=O)C2 |
| InChI | InChI=1S/C28H23Cl3F2N4O5S/c1-41-7-3-6-36(14-38)19-8-16-12-37(13-17(16)9-20(19)42-2)27(40)23-21(10-22(28(31,32)33)35-26(23)39)43-25-18(29)5-4-15(11-34)24(25)30/h4-5,8-10,14H,3,6-7,12-13H2,1-2H3,(H,35,39) |
| InChIKey | CMJQFZJTVPJGDB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.94 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|