C14H8Cl3F2NO4S — CID 177239688
6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-methoxyphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 177239688) has the molecular formula C14H8Cl3F2NO4S and a molecular weight of 430.64 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-methoxyphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-methoxyphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 177239688 |
| Molecular Formula | C14H8Cl3F2NO4S |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 428.92 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-methoxyphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | COc1ccc(Cl)c(Sc2cc(C(F)(F)Cl)[nH]c(=O)c2C(=O)O)c1Cl |
| InChI | InChI=1S/C14H8Cl3F2NO4S/c1-24-6-3-2-5(15)11(10(6)16)25-7-4-8(14(17,18)19)20-12(21)9(7)13(22)23/h2-4H,1H3,(H,20,21)(H,22,23) |
| InChIKey | AXNJSEPJTXNIIP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|