C14H8Cl3F2NO3S — CID 177239635
6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-methoxyphenyl)sulfanyl-2-oxo-1H-pyridine-3-carbaldehyde (PubChem CID 177239635) has the molecular formula C14H8Cl3F2NO3S and a molecular weight of 414.64 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-methoxyphenyl)sulfanyl-2-oxo-1H-pyridine-3-carbaldehyde.
| Compound Name | 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-methoxyphenyl)sulfanyl-2-oxo-1H-pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 177239635 |
| Molecular Formula | C14H8Cl3F2NO3S |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-methoxyphenyl)sulfanyl-2-oxo-1H-pyridine-3-carbaldehyde |
| SMILES | COc1ccc(Cl)c(Sc2cc(C(F)(F)Cl)[nH]c(=O)c2C=O)c1Cl |
| InChI | InChI=1S/C14H8Cl3F2NO3S/c1-23-8-3-2-7(15)12(11(8)16)24-9-4-10(14(17,18)19)20-13(22)6(9)5-21/h2-5H,1H3,(H,20,22) |
| InChIKey | XSZWNXDGRQKYHV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|