C15H9BrCl3F2NO3S — CID 177238508
ethyl 4-(3-bromo-2,6-dichlorophenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 177238508) has the molecular formula C15H9BrCl3F2NO3S and a molecular weight of 507.57 g/mol. Its IUPAC name is ethyl 4-(3-bromo-2,6-dichlorophenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 4-(3-bromo-2,6-dichlorophenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177238508 |
| Molecular Formula | C15H9BrCl3F2NO3S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 504.85 |
| IUPAC Name | ethyl 4-(3-bromo-2,6-dichlorophenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Sc2c(Cl)ccc(Br)c2Cl)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C15H9BrCl3F2NO3S/c1-2-25-14(24)10-8(5-9(15(19,20)21)22-13(10)23)26-12-7(17)4-3-6(16)11(12)18/h3-5H,2H2,1H3,(H,22,23) |
| InChIKey | QSHSDHCJFPUNMX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|