C15H13Cl3F2N2O3S — CID 177238470
4-[3-(aminomethyl)-2,6-dichlorophenyl]sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carbaldehyde;methanol (PubChem CID 177238470) has the molecular formula C15H13Cl3F2N2O3S and a molecular weight of 445.70 g/mol. Its IUPAC name is 4-[3-(aminomethyl)-2,6-dichlorophenyl]sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carbaldehyde;methanol.
| Compound Name | 4-[3-(aminomethyl)-2,6-dichlorophenyl]sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carbaldehyde;methanol |
|---|---|
| PubChem CID | 177238470 |
| Molecular Formula | C15H13Cl3F2N2O3S |
| Molecular Weight | 445.70 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | 4-[3-(aminomethyl)-2,6-dichlorophenyl]sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carbaldehyde;methanol |
| SMILES | CO.NCc1ccc(Cl)c(Sc2cc(C(F)(F)Cl)[nH]c(=O)c2C=O)c1Cl |
| InChI | InChI=1S/C14H9Cl3F2N2O2S.CH4O/c15-8-2-1-6(4-20)11(16)12(8)24-9-3-10(14(17,18)19)21-13(23)7(9)5-22;1-2/h1-3,5H,4,20H2,(H,21,23);2H,1H3 |
| InChIKey | YZGYYZUWLCHPOM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|