C21H24Cl3F2NO4 — CID 177238797
2,4-dichloro-3-methylbenzaldehyde;ethyl 6-[chloro(difluoro)methyl]-4-methyl-2-oxo-1H-pyridine-3-carboxylate;propane (PubChem CID 177238797) has the molecular formula C21H24Cl3F2NO4 and a molecular weight of 498.78 g/mol. Its IUPAC name is 2,4-dichloro-3-methylbenzaldehyde;ethyl 6-[chloro(difluoro)methyl]-4-methyl-2-oxo-1H-pyridine-3-carboxylate;propane.
| Compound Name | 2,4-dichloro-3-methylbenzaldehyde;ethyl 6-[chloro(difluoro)methyl]-4-methyl-2-oxo-1H-pyridine-3-carboxylate;propane |
|---|---|
| PubChem CID | 177238797 |
| Molecular Formula | C21H24Cl3F2NO4 |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2,4-dichloro-3-methylbenzaldehyde;ethyl 6-[chloro(difluoro)methyl]-4-methyl-2-oxo-1H-pyridine-3-carboxylate;propane |
| SMILES | CCC.CCOC(=O)c1c(C)cc(C(F)(F)Cl)[nH]c1=O.Cc1c(Cl)ccc(C=O)c1Cl |
| InChI | InChI=1S/C10H10ClF2NO3.C8H6Cl2O.C3H8/c1-3-17-9(16)7-5(2)4-6(10(11,12)13)14-8(7)15;1-5-7(9)3-2-6(4-11)8(5)10;1-3-2/h4H,3H2,1-2H3,(H,14,15);2-4H,1H3;3H2,1-2H3 |
| InChIKey | KEOJBQBQZRRPSL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|