C16H10Cl3F2NO4S — CID 177239268
ethyl 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-formylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 177239268) has the molecular formula C16H10Cl3F2NO4S and a molecular weight of 456.68 g/mol. Its IUPAC name is ethyl 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-formylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-formylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177239268 |
| Molecular Formula | C16H10Cl3F2NO4S |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 454.94 |
| IUPAC Name | ethyl 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-formylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Sc2c(Cl)ccc(C=O)c2Cl)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C16H10Cl3F2NO4S/c1-2-26-15(25)11-9(5-10(16(19,20)21)22-14(11)24)27-13-8(17)4-3-7(6-23)12(13)18/h3-6H,2H2,1H3,(H,22,24) |
| InChIKey | PVMJEXTWUBZUEG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|