C17H14Cl3F2NO3S — CID 177239342
ethyl 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-ethylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 177239342) has the molecular formula C17H14Cl3F2NO3S and a molecular weight of 456.73 g/mol. Its IUPAC name is ethyl 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-ethylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-ethylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177239342 |
| Molecular Formula | C17H14Cl3F2NO3S |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 454.97 |
| IUPAC Name | ethyl 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-ethylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Sc2c(Cl)ccc(CC)c2Cl)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C17H14Cl3F2NO3S/c1-3-8-5-6-9(18)14(13(8)19)27-10-7-11(17(20,21)22)23-15(24)12(10)16(25)26-4-2/h5-7H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | LERMVWGSEZGEDP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|