C15H9Cl4F2NO3S — CID 177238585
ethyl 6-[dichloro(fluoro)methyl]-4-(2,6-dichloro-3-fluorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 177238585) has the molecular formula C15H9Cl4F2NO3S and a molecular weight of 463.12 g/mol. Its IUPAC name is ethyl 6-[dichloro(fluoro)methyl]-4-(2,6-dichloro-3-fluorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-[dichloro(fluoro)methyl]-4-(2,6-dichloro-3-fluorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177238585 |
| Molecular Formula | C15H9Cl4F2NO3S |
| Molecular Weight | 463.12 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | ethyl 6-[dichloro(fluoro)methyl]-4-(2,6-dichloro-3-fluorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Sc2c(Cl)ccc(F)c2Cl)cc(C(F)(Cl)Cl)[nH]c1=O |
| InChI | InChI=1S/C15H9Cl4F2NO3S/c1-2-25-14(24)10-8(5-9(15(18,19)21)22-13(10)23)26-12-6(16)3-4-7(20)11(12)17/h3-5H,2H2,1H3,(H,22,23) |
| InChIKey | WBGDGZHLLZJNSV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.12 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|