C15H10Cl2F2INO3S — CID 177238730
ethyl 6-[chloro(difluoro)methyl]-4-(2-chloro-6-iodophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 177238730) has the molecular formula C15H10Cl2F2INO3S and a molecular weight of 520.12 g/mol. Its IUPAC name is ethyl 6-[chloro(difluoro)methyl]-4-(2-chloro-6-iodophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-[chloro(difluoro)methyl]-4-(2-chloro-6-iodophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177238730 |
| Molecular Formula | C15H10Cl2F2INO3S |
| Molecular Weight | 520.12 g/mol |
| Exact Mass | 518.88 |
| IUPAC Name | ethyl 6-[chloro(difluoro)methyl]-4-(2-chloro-6-iodophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Sc2c(Cl)cccc2I)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C15H10Cl2F2INO3S/c1-2-24-14(23)11-9(6-10(15(17,18)19)21-13(11)22)25-12-7(16)4-3-5-8(12)20/h3-6H,2H2,1H3,(H,21,22) |
| InChIKey | NQAONMIPGFRUSN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.12 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|