C16H10Cl2F2N2O3S — CID 177238830
ethyl 4-(2-chloro-6-cyanophenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 177238830) has the molecular formula C16H10Cl2F2N2O3S and a molecular weight of 419.24 g/mol. Its IUPAC name is ethyl 4-(2-chloro-6-cyanophenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 4-(2-chloro-6-cyanophenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177238830 |
| Molecular Formula | C16H10Cl2F2N2O3S |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | ethyl 4-(2-chloro-6-cyanophenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Sc2c(Cl)cccc2C#N)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C16H10Cl2F2N2O3S/c1-2-25-15(24)12-10(6-11(16(18,19)20)22-14(12)23)26-13-8(7-21)4-3-5-9(13)17/h3-6H,2H2,1H3,(H,22,23) |
| InChIKey | GZRZQDUVTCFDDD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|