C17H13Cl2F2NO3S — CID 177238716
ethyl 6-[chloro(difluoro)methyl]-4-(2-chloro-6-ethenylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 177238716) has the molecular formula C17H13Cl2F2NO3S and a molecular weight of 420.26 g/mol. Its IUPAC name is ethyl 6-[chloro(difluoro)methyl]-4-(2-chloro-6-ethenylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-[chloro(difluoro)methyl]-4-(2-chloro-6-ethenylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177238716 |
| Molecular Formula | C17H13Cl2F2NO3S |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | ethyl 6-[chloro(difluoro)methyl]-4-(2-chloro-6-ethenylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | C=Cc1cccc(Cl)c1Sc1cc(C(F)(F)Cl)[nH]c(=O)c1C(=O)OCC |
| InChI | InChI=1S/C17H13Cl2F2NO3S/c1-3-9-6-5-7-10(18)14(9)26-11-8-12(17(19,20)21)22-15(23)13(11)16(24)25-4-2/h3,5-8H,1,4H2,2H3,(H,22,23) |
| InChIKey | QJYVHXRMABHCKL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|