C16H11Cl2F2NO3S — CID 177238620
4-(2-chloro-6-cyclopropylphenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 177238620) has the molecular formula C16H11Cl2F2NO3S and a molecular weight of 406.24 g/mol. Its IUPAC name is 4-(2-chloro-6-cyclopropylphenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-(2-chloro-6-cyclopropylphenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 177238620 |
| Molecular Formula | C16H11Cl2F2NO3S |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 4-(2-chloro-6-cyclopropylphenyl)sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(Sc2c(Cl)cccc2C2CC2)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C16H11Cl2F2NO3S/c17-9-3-1-2-8(7-4-5-7)13(9)25-10-6-11(16(18,19)20)21-14(22)12(10)15(23)24/h1-3,6-7H,4-5H2,(H,21,22)(H,23,24) |
| InChIKey | JZSDFSVPNZPALY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|