C14H9Cl2F2NO3S — CID 177238837
6-[chloro(difluoro)methyl]-4-(2-chloro-6-methylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 177238837) has the molecular formula C14H9Cl2F2NO3S and a molecular weight of 380.20 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-4-(2-chloro-6-methylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-[chloro(difluoro)methyl]-4-(2-chloro-6-methylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 177238837 |
| Molecular Formula | C14H9Cl2F2NO3S |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-4-(2-chloro-6-methylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | Cc1cccc(Cl)c1Sc1cc(C(F)(F)Cl)[nH]c(=O)c1C(=O)O |
| InChI | InChI=1S/C14H9Cl2F2NO3S/c1-6-3-2-4-7(15)11(6)23-8-5-9(14(16,17)18)19-12(20)10(8)13(21)22/h2-5H,1H3,(H,19,20)(H,21,22) |
| InChIKey | IGLAMKAYSUKGTJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|