C15H11Cl2F2NO2S — CID 177238761
3-acetyl-6-[chloro(difluoro)methyl]-4-(2-chloro-6-methylphenyl)sulfanyl-1H-pyridin-2-one (PubChem CID 177238761) has the molecular formula C15H11Cl2F2NO2S and a molecular weight of 378.23 g/mol. Its IUPAC name is 3-acetyl-6-[chloro(difluoro)methyl]-4-(2-chloro-6-methylphenyl)sulfanyl-1H-pyridin-2-one.
| Compound Name | 3-acetyl-6-[chloro(difluoro)methyl]-4-(2-chloro-6-methylphenyl)sulfanyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 177238761 |
| Molecular Formula | C15H11Cl2F2NO2S |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 3-acetyl-6-[chloro(difluoro)methyl]-4-(2-chloro-6-methylphenyl)sulfanyl-1H-pyridin-2-one |
| SMILES | CC(=O)c1c(Sc2c(C)cccc2Cl)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C15H11Cl2F2NO2S/c1-7-4-3-5-9(16)13(7)23-10-6-11(15(17,18)19)20-14(22)12(10)8(2)21/h3-6H,1-2H3,(H,20,22) |
| InChIKey | OVNZXRIQKJARPL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|