C14H8Cl3F2NO2S — CID 177238981
2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-methyl-2-oxo-1H-pyridin-4-yl]sulfanyl]benzaldehyde (PubChem CID 177238981) has the molecular formula C14H8Cl3F2NO2S and a molecular weight of 398.65 g/mol. Its IUPAC name is 2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-methyl-2-oxo-1H-pyridin-4-yl]sulfanyl]benzaldehyde.
| Compound Name | 2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-methyl-2-oxo-1H-pyridin-4-yl]sulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 177238981 |
| Molecular Formula | C14H8Cl3F2NO2S |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-methyl-2-oxo-1H-pyridin-4-yl]sulfanyl]benzaldehyde |
| SMILES | Cc1c(Sc2c(Cl)ccc(C=O)c2Cl)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C14H8Cl3F2NO2S/c1-6-9(4-10(14(17,18)19)20-13(6)22)23-12-8(15)3-2-7(5-21)11(12)16/h2-5H,1H3,(H,20,22) |
| InChIKey | WHUXPAJZHLXFQE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|