C14H5Cl3F2N2O3S — CID 177239174
6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-cyanophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 177239174) has the molecular formula C14H5Cl3F2N2O3S and a molecular weight of 425.63 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-cyanophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-cyanophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 177239174 |
| Molecular Formula | C14H5Cl3F2N2O3S |
| Molecular Weight | 425.63 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-cyanophenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | N#Cc1ccc(Cl)c(Sc2cc(C(F)(F)Cl)[nH]c(=O)c2C(=O)O)c1Cl |
| InChI | InChI=1S/C14H5Cl3F2N2O3S/c15-6-2-1-5(4-20)10(16)11(6)25-7-3-8(14(17,18)19)21-12(22)9(7)13(23)24/h1-3H,(H,21,22)(H,23,24) |
| InChIKey | OJNASWULAIVFAH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|