C18H17Cl3F2N2O3S2 — CID 177238810
4-[3-[(tert-butylsulfanylamino)methyl]-2,6-dichlorophenyl]sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 177238810) has the molecular formula C18H17Cl3F2N2O3S2 and a molecular weight of 517.83 g/mol. Its IUPAC name is 4-[3-[(tert-butylsulfanylamino)methyl]-2,6-dichlorophenyl]sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-[3-[(tert-butylsulfanylamino)methyl]-2,6-dichlorophenyl]sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 177238810 |
| Molecular Formula | C18H17Cl3F2N2O3S2 |
| Molecular Weight | 517.83 g/mol |
| Exact Mass | 515.97 |
| IUPAC Name | 4-[3-[(tert-butylsulfanylamino)methyl]-2,6-dichlorophenyl]sulfanyl-6-[chloro(difluoro)methyl]-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)SNCc1ccc(Cl)c(Sc2cc(C(F)(F)Cl)[nH]c(=O)c2C(=O)O)c1Cl |
| InChI | InChI=1S/C18H17Cl3F2N2O3S2/c1-17(2,3)30-24-7-8-4-5-9(19)14(13(8)20)29-10-6-11(18(21,22)23)25-15(26)12(10)16(27)28/h4-6,24H,7H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | XJDFFIQYWIKRRD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.83 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|