C15H10Cl3F2NO3S — CID 177239263
6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-ethylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 177239263) has the molecular formula C15H10Cl3F2NO3S and a molecular weight of 428.67 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-ethylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-ethylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 177239263 |
| Molecular Formula | C15H10Cl3F2NO3S |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-4-(2,6-dichloro-3-ethylphenyl)sulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CCc1ccc(Cl)c(Sc2cc(C(F)(F)Cl)[nH]c(=O)c2C(=O)O)c1Cl |
| InChI | InChI=1S/C15H10Cl3F2NO3S/c1-2-6-3-4-7(16)12(11(6)17)25-8-5-9(15(18,19)20)21-13(22)10(8)14(23)24/h3-5H,2H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | DLGNXQQGGCCSHM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|