C22H41N2OPb — CID 177239842
CID 177239842 (PubChem CID 177239842) has the molecular formula C22H41N2OPb and a molecular weight of 556.78 g/mol.
| Compound Name | CID 177239842 |
|---|---|
| PubChem CID | 177239842 |
| Molecular Formula | C22H41N2OPb |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | — |
| SMILES | CC.CC(C)(CNCC[Pb])COCC(C)(C)CNCCc1ccccc1 |
| InChI | InChI=1S/C20H35N2O.C2H6.Pb/c1-6-21-14-19(2,3)16-23-17-20(4,5)15-22-13-12-18-10-8-7-9-11-18;1-2;/h7-11,21-22H,1,6,12-17H2,2-5H3;1-2H3; |
| InChIKey | XBYJYJVALFGHGG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|