C20H35N2OPb — CID 177239843
CID 177239843 (PubChem CID 177239843) has the molecular formula C20H35N2OPb and a molecular weight of 526.71 g/mol.
| Compound Name | CID 177239843 |
|---|---|
| PubChem CID | 177239843 |
| Molecular Formula | C20H35N2OPb |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | — |
| SMILES | CC(C)(CNCC[Pb])COCC(C)(C)CNCCc1ccccc1 |
| InChI | InChI=1S/C20H35N2O.Pb/c1-6-21-14-19(2,3)16-23-17-20(4,5)15-22-13-12-18-10-8-7-9-11-18;/h7-11,21-22H,1,6,12-17H2,2-5H3; |
| InChIKey | LKUXNHJVQZPYOQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|