About 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole
3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole (PubChem CID 177243667) has the molecular formula C14H24F2N2O3
and a molecular weight of 306.35 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole |
| PubChem CID | 177243667 |
| Molecular Formula | C14H24F2N2O3 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole |
| SMILES | CC.CC.COc1cc(C)on1.Cc1cc(C(F)F)no1 |
| InChI | InChI=1S/C5H5F2NO.C5H7NO2.2C2H6/c1-3-2-4(5(6)7)8-9-3;1-4-3-5(7-2)6-8-4;2*1-2/h2,5H,1H3;3H,1-2H3;2*1-2H3 |
| InChIKey | GEDWFUKNYURRNU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole?
The IUPAC name of 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole (CID 177243667) is 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole.
What is the SMILES notation for 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole?
The canonical SMILES for 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole is CC.CC.COc1cc(C)on1.Cc1cc(C(F)F)no1.
What is the InChIKey of 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole?
The InChIKey is GEDWFUKNYURRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F2NO.C5H7NO2.2C2H6/c1-3-2-4(5(6)7)8-9-3;1-4-3-5(7-2)6-8-4;2*1-2/h2,5H,1H3;3H,1-2H3;2*1-2H3.
What are the key properties of 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole?
3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole has a molecular weight of 306.35 g/mol, XLogP of 4.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-5-methyl-1,2-oxazole;ethane;3-methoxy-5-methyl-1,2-oxazole is sourced from PubChem (CID 177243667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).