C8H9F2N3O2 — CID 177243780
6-(difluoromethoxy)-N'-methylpyridine-3-carbohydrazide (PubChem CID 177243780) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.18 g/mol. Its IUPAC name is 6-(difluoromethoxy)-N'-methylpyridine-3-carbohydrazide.
| Compound Name | 6-(difluoromethoxy)-N'-methylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 177243780 |
| Molecular Formula | C8H9F2N3O2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 6-(difluoromethoxy)-N'-methylpyridine-3-carbohydrazide |
| SMILES | CNNC(=O)c1ccc(OC(F)F)nc1 |
| InChI | InChI=1S/C8H9F2N3O2/c1-11-13-7(14)5-2-3-6(12-4-5)15-8(9)10/h2-4,8,11H,1H3,(H,13,14) |
| InChIKey | LEAXUWXSJSEDAD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|