C20H21F3N4O2 — CID 177245369
ethane;3-methoxy-6-[4-[[3-(trifluoromethyl)phenyl]methoxy]-2-pyridinyl]pyridazin-4-amine (PubChem CID 177245369) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is ethane;3-methoxy-6-[4-[[3-(trifluoromethyl)phenyl]methoxy]-2-pyridinyl]pyridazin-4-amine.
| Compound Name | ethane;3-methoxy-6-[4-[[3-(trifluoromethyl)phenyl]methoxy]-2-pyridinyl]pyridazin-4-amine |
|---|---|
| PubChem CID | 177245369 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | ethane;3-methoxy-6-[4-[[3-(trifluoromethyl)phenyl]methoxy]-2-pyridinyl]pyridazin-4-amine |
| SMILES | CC.COc1nnc(-c2cc(OCc3cccc(C(F)(F)F)c3)ccn2)cc1N |
| InChI | InChI=1S/C18H15F3N4O2.C2H6/c1-26-17-14(22)9-16(24-25-17)15-8-13(5-6-23-15)27-10-11-3-2-4-12(7-11)18(19,20)21;1-2/h2-9H,10H2,1H3,(H2,22,24);1-2H3 |
| InChIKey | LKDWQEHCGDMOTL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |