C34H39N3O5 — CID 177247339
5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[3-[4-[4-[4-(prop-2-ynylamino)phenoxy]butoxy]butoxy]phenyl]methyl]pyridin-2-one (PubChem CID 177247339) has the molecular formula C34H39N3O5 and a molecular weight of 569.70 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[3-[4-[4-[4-(prop-2-ynylamino)phenoxy]butoxy]butoxy]phenyl]methyl]pyridin-2-one.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[3-[4-[4-[4-(prop-2-ynylamino)phenoxy]butoxy]butoxy]phenyl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 177247339 |
| Molecular Formula | C34H39N3O5 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[3-[4-[4-[4-(prop-2-ynylamino)phenoxy]butoxy]butoxy]phenyl]methyl]pyridin-2-one |
| SMILES | C#CCNc1ccc(OCCCCOCCCCOc2cccc(Cn3cc(-c4c(C)noc4C)ccc3=O)c2)cc1 |
| InChI | InChI=1S/C34H39N3O5/c1-4-18-35-30-13-15-31(16-14-30)40-21-7-5-19-39-20-6-8-22-41-32-11-9-10-28(23-32)24-37-25-29(12-17-33(37)38)34-26(2)36-42-27(34)3/h1,9-17,23,25,35H,5-8,18-22,24H2,2-3H3 |
| InChIKey | KPDWKXSJKUCJCP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|