C16H12ClF2N3 — CID 177249429
N-[(4-chlorophenyl)methyl]-6,8-difluoro-2-methylquinazolin-4-amine (PubChem CID 177249429) has the molecular formula C16H12ClF2N3 and a molecular weight of 319.74 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-6,8-difluoro-2-methylquinazolin-4-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-6,8-difluoro-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 177249429 |
| Molecular Formula | C16H12ClF2N3 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-6,8-difluoro-2-methylquinazolin-4-amine |
| SMILES | Cc1nc(NCc2ccc(Cl)cc2)c2cc(F)cc(F)c2n1 |
| InChI | InChI=1S/C16H12ClF2N3/c1-9-21-15-13(6-12(18)7-14(15)19)16(22-9)20-8-10-2-4-11(17)5-3-10/h2-7H,8H2,1H3,(H,20,21,22) |
| InChIKey | BULMNKWFBSQCCS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |