C22H19ClF4N4O — CID 177249636
(4-aminopiperidin-1-yl)-[2-(3-chloro-4-fluorophenyl)-3-[(3,4,5-trifluorophenyl)methyl]imidazol-4-yl]methanone (PubChem CID 177249636) has the molecular formula C22H19ClF4N4O and a molecular weight of 466.87 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[2-(3-chloro-4-fluorophenyl)-3-[(3,4,5-trifluorophenyl)methyl]imidazol-4-yl]methanone.
| Compound Name | (4-aminopiperidin-1-yl)-[2-(3-chloro-4-fluorophenyl)-3-[(3,4,5-trifluorophenyl)methyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 177249636 |
| Molecular Formula | C22H19ClF4N4O |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[2-(3-chloro-4-fluorophenyl)-3-[(3,4,5-trifluorophenyl)methyl]imidazol-4-yl]methanone |
| SMILES | NC1CCN(C(=O)c2cnc(-c3ccc(F)c(Cl)c3)n2Cc2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C22H19ClF4N4O/c23-15-9-13(1-2-16(15)24)21-29-10-19(22(32)30-5-3-14(28)4-6-30)31(21)11-12-7-17(25)20(27)18(26)8-12/h1-2,7-10,14H,3-6,11,28H2 |
| InChIKey | DIAPVVMZLFIEIC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|