C20H18F3N5O — CID 118215079
(4-aminopiperidin-1-yl)-[5-pyridin-2-yl-1-(3,4,5-trifluorophenyl)pyrazol-3-yl]methanone (PubChem CID 118215079) has the molecular formula C20H18F3N5O and a molecular weight of 401.39 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[5-pyridin-2-yl-1-(3,4,5-trifluorophenyl)pyrazol-3-yl]methanone.
| Compound Name | (4-aminopiperidin-1-yl)-[5-pyridin-2-yl-1-(3,4,5-trifluorophenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 118215079 |
| Molecular Formula | C20H18F3N5O |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[5-pyridin-2-yl-1-(3,4,5-trifluorophenyl)pyrazol-3-yl]methanone |
| SMILES | NC1CCN(C(=O)c2cc(-c3ccccn3)n(-c3cc(F)c(F)c(F)c3)n2)CC1 |
| InChI | InChI=1S/C20H18F3N5O/c21-14-9-13(10-15(22)19(14)23)28-18(16-3-1-2-6-25-16)11-17(26-28)20(29)27-7-4-12(24)5-8-27/h1-3,6,9-12H,4-5,7-8,24H2 |
| InChIKey | SJJOQUKEQPHNIJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|