C19H19N5O3 — CID 23090523
[1-(6-methoxy-3-pyridinyl)-5-pyridin-2-ylpyrazol-3-yl]-morpholin-4-ylmethanone (PubChem CID 23090523) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is [1-(6-methoxy-3-pyridinyl)-5-pyridin-2-ylpyrazol-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(6-methoxy-3-pyridinyl)-5-pyridin-2-ylpyrazol-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 23090523 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | [1-(6-methoxy-3-pyridinyl)-5-pyridin-2-ylpyrazol-3-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(-n2nc(C(=O)N3CCOCC3)cc2-c2ccccn2)cn1 |
| InChI | InChI=1S/C19H19N5O3/c1-26-18-6-5-14(13-21-18)24-17(15-4-2-3-7-20-15)12-16(22-24)19(25)23-8-10-27-11-9-23/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | GHRDMUZCVJMWRS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |