C18H19N7O3 — CID 59003665
[5-(5-aminopyrazin-2-yl)-1-(6-methoxy-3-pyridinyl)pyrazol-3-yl]-morpholin-4-ylmethanone (PubChem CID 59003665) has the molecular formula C18H19N7O3 and a molecular weight of 381.40 g/mol. Its IUPAC name is [5-(5-aminopyrazin-2-yl)-1-(6-methoxy-3-pyridinyl)pyrazol-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [5-(5-aminopyrazin-2-yl)-1-(6-methoxy-3-pyridinyl)pyrazol-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 59003665 |
| Molecular Formula | C18H19N7O3 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [5-(5-aminopyrazin-2-yl)-1-(6-methoxy-3-pyridinyl)pyrazol-3-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(-n2nc(C(=O)N3CCOCC3)cc2-c2cnc(N)cn2)cn1 |
| InChI | InChI=1S/C18H19N7O3/c1-27-17-3-2-12(9-22-17)25-15(14-10-21-16(19)11-20-14)8-13(23-25)18(26)24-4-6-28-7-5-24/h2-3,8-11H,4-7H2,1H3,(H2,19,21) |
| InChIKey | KOSHZGLTHIEIMA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |