C25H24N6O2 — CID 23090210
[1-(6-methoxy-3-pyridinyl)-5-phenylpyrazol-3-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 23090210) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is [1-(6-methoxy-3-pyridinyl)-5-phenylpyrazol-3-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [1-(6-methoxy-3-pyridinyl)-5-phenylpyrazol-3-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 23090210 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [1-(6-methoxy-3-pyridinyl)-5-phenylpyrazol-3-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(-n2nc(C(=O)N3CCN(c4ccccn4)CC3)cc2-c2ccccc2)cn1 |
| InChI | InChI=1S/C25H24N6O2/c1-33-24-11-10-20(18-27-24)31-22(19-7-3-2-4-8-19)17-21(28-31)25(32)30-15-13-29(14-16-30)23-9-5-6-12-26-23/h2-12,17-18H,13-16H2,1H3 |
| InChIKey | SRCYECLQKUMXOZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |