C17H15N3O4 — CID 23090117
5-(3-methoxyphenyl)-1-(6-methoxy-3-pyridinyl)pyrazole-3-carboxylic acid (PubChem CID 23090117) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-1-(6-methoxy-3-pyridinyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-(3-methoxyphenyl)-1-(6-methoxy-3-pyridinyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 23090117 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 5-(3-methoxyphenyl)-1-(6-methoxy-3-pyridinyl)pyrazole-3-carboxylic acid |
| SMILES | COc1cccc(-c2cc(C(=O)O)nn2-c2ccc(OC)nc2)c1 |
| InChI | InChI=1S/C17H15N3O4/c1-23-13-5-3-4-11(8-13)15-9-14(17(21)22)19-20(15)12-6-7-16(24-2)18-10-12/h3-10H,1-2H3,(H,21,22) |
| InChIKey | HMKNVUGCMWCJNB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |