C22H22N4O4 — CID 23090254
1-[1-(6-methoxy-3-pyridinyl)-5-phenylpyrazole-3-carbonyl]piperidine-2-carboxylic acid (PubChem CID 23090254) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 1-[1-(6-methoxy-3-pyridinyl)-5-phenylpyrazole-3-carbonyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[1-(6-methoxy-3-pyridinyl)-5-phenylpyrazole-3-carbonyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23090254 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[1-(6-methoxy-3-pyridinyl)-5-phenylpyrazole-3-carbonyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc(-n2nc(C(=O)N3CCCCC3C(=O)O)cc2-c2ccccc2)cn1 |
| InChI | InChI=1S/C22H22N4O4/c1-30-20-11-10-16(14-23-20)26-19(15-7-3-2-4-8-15)13-17(24-26)21(27)25-12-6-5-9-18(25)22(28)29/h2-4,7-8,10-11,13-14,18H,5-6,9,12H2,1H3,(H,28,29) |
| InChIKey | MSYBZOBCIHVNHK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |