C27H32N4O5 — CID 177250750
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-[4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]ethyl]propanamide (PubChem CID 177250750) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-[4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]ethyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-[4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 177250750 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-[4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]ethyl]propanamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(CCNC(=O)CCN3C(=O)NC4(CCCC4)C3=O)cc2)c1 |
| InChI | InChI=1S/C27H32N4O5/c1-19-5-4-6-21(17-19)29-24(33)18-36-22-9-7-20(8-10-22)11-15-28-23(32)12-16-31-25(34)27(30-26(31)35)13-2-3-14-27/h4-10,17H,2-3,11-16,18H2,1H3,(H,28,32)(H,29,33)(H,30,35) |
| InChIKey | OIBAEYCNPDWRDY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|