C26H33ClN4S — CID 177252938
4-chloro-1-methyl-6-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-2-(thian-4-yl)benzimidazole (PubChem CID 177252938) has the molecular formula C26H33ClN4S and a molecular weight of 469.10 g/mol. Its IUPAC name is 4-chloro-1-methyl-6-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-2-(thian-4-yl)benzimidazole.
| Compound Name | 4-chloro-1-methyl-6-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-2-(thian-4-yl)benzimidazole |
|---|---|
| PubChem CID | 177252938 |
| Molecular Formula | C26H33ClN4S |
| Molecular Weight | 469.10 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-chloro-1-methyl-6-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-2-(thian-4-yl)benzimidazole |
| SMILES | CC(C)N1CCN(c2ccc(-c3cc(Cl)c4nc(C5CCSCC5)n(C)c4c3)cc2)CC1 |
| InChI | InChI=1S/C26H33ClN4S/c1-18(2)30-10-12-31(13-11-30)22-6-4-19(5-7-22)21-16-23(27)25-24(17-21)29(3)26(28-25)20-8-14-32-15-9-20/h4-7,16-18,20H,8-15H2,1-3H3 |
| InChIKey | VVXAYLYRORKCJI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.10 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |