C26H35N7 — CID 140543119
N-(4-methylpiperazin-1-yl)-6-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinazolin-2-amine (PubChem CID 140543119) has the molecular formula C26H35N7 and a molecular weight of 445.62 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-6-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinazolin-2-amine.
| Compound Name | N-(4-methylpiperazin-1-yl)-6-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 140543119 |
| Molecular Formula | C26H35N7 |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-6-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinazolin-2-amine |
| SMILES | CC(C)N1CCN(c2ccc(-c3ccc4nc(NN5CCN(C)CC5)ncc4c3)cc2)CC1 |
| InChI | InChI=1S/C26H35N7/c1-20(2)31-12-14-32(15-13-31)24-7-4-21(5-8-24)22-6-9-25-23(18-22)19-27-26(28-25)29-33-16-10-30(3)11-17-33/h4-9,18-20H,10-17H2,1-3H3,(H,27,28,29) |
| InChIKey | ACNXDAYBCYWWDR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |