C23H23N5S — CID 140543118
N-(4-methylpiperazin-1-yl)-6-(5-phenylthiophen-2-yl)quinazolin-2-amine (PubChem CID 140543118) has the molecular formula C23H23N5S and a molecular weight of 401.54 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-6-(5-phenylthiophen-2-yl)quinazolin-2-amine.
| Compound Name | N-(4-methylpiperazin-1-yl)-6-(5-phenylthiophen-2-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 140543118 |
| Molecular Formula | C23H23N5S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-6-(5-phenylthiophen-2-yl)quinazolin-2-amine |
| SMILES | CN1CCN(Nc2ncc3cc(-c4ccc(-c5ccccc5)s4)ccc3n2)CC1 |
| InChI | InChI=1S/C23H23N5S/c1-27-11-13-28(14-12-27)26-23-24-16-19-15-18(7-8-20(19)25-23)22-10-9-21(29-22)17-5-3-2-4-6-17/h2-10,15-16H,11-14H2,1H3,(H,24,25,26) |
| InChIKey | FUONGKNSOIIXKB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |